Nateglinide
Catalog No: FT-0631035
CAS No: 105816-04-4
- Chemical Name: Nateglinide
- Molecular Formula: C19H27NO3
- Molecular Weight: 317.4
- InChI Key: OELFLUMRDSZNSF-OFLPRAFFSA-N
- InChI: InChI=1S/C19H27NO3/c1-13(2)15-8-10-16(11-9-15)18(21)20-17(19(22)23)12-14-6-4-3-5-7-14/h3-7,13,15-17H,8-12H2,1-2H3,(H,20,21)(H,22,23)/t15?,16?,17-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 317.423 |
|---|---|
| CAS: | 105816-04-4 |
| Melting_Point: | 137-141ºC |
| Bolling_Point: | 527.6±39.0 °C at 760 mmHg |
| MF: | C19H27NO3 |
| Product_Name: | Nateglinide |
| Flash_Point: | 272.9±27.1 °C |
| Density: | 1.1±0.1 g/cm3 |
| FW: | 317.423 |
|---|---|
| MF: | C19H27NO3 |
| Flash_Point: | 272.9±27.1 °C |
| Refractive_Index: | 1.536 |
| Bolling_Point: | 527.6±39.0 °C at 760 mmHg |
| PSA: | 66.40000 |
| Exact_Mass: | 317.199097 |
| Vapor_Pressure: | 0.0±1.5 mmHg at 25°C |
| LogP: | 4.21 |
| Melting_Point: | 137-141ºC |
| Density: | 1.1±0.1 g/cm3 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RTECS: | SQ7318950 |
| HS_Code: | 2924299090 |
| Safety_Statements: | 24/25-36 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R22 |
| Hazard_Codes: | Xn: Harmful; |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)